CAS No.: | 76-62-0 |
---|---|
Formula: | C20h10br4o4 |
EINECS: | 200-974-9 |
Appearance: | Powder |
Classification: | S |
Certification: | CCIC |
Customization: |
---|
Suppliers with verified business licenses
Name | 3',3'',5',5''-Tetrabromophenolphthalein |
---|---|
Synonyms | 3,3-Bis(3,5-Dibromo-4-Hydroxy-Phenyl)Isobenzofuran-1-One; 3,3-Bis(3,5-Dibromo-4-Hydroxyphenyl)-1-Isobenzofuranone; 3,3-Bis(3,5-Dibromo-4-Hydroxy-Phenyl)-2-Benzofuran-1-One |
Molecular Structure | |
Molecular Formula | C20H10Br4O4 |
Molecular Weight | 633.91 |
CAS Registry Number | 76-62-0 |
EINECS | 200-974-9 |
SMILES | C1=CC=CC4=C1C(C2=CC(=C(O)C(=C2)Br)Br)(C3=CC(=C(C(=C3)Br)O)Br)OC4=O |
InChI | 1S/C20H10Br4O4/c21-13-5-9(6-14(22)17(13)25)20(10-7-15(23)18(26)16(24)8-10)12-4-2-1-3-11(12)19(27)28-20/h1-8,25-26H |
InChIKey | OBRGVMYQZVQHGO-UHFFFAOYSA-N |
Desity | 2.2±0.1g/cm3 (Cal.) |
---|---|
Boiling point | 598.6±50.0°C at 760 mmHg (Cal.) |
Flash point | 315.8±30.1°C (Cal.) |
Suppliers with verified business licenses